| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Alfa Pyridines | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| Axon MedChem BV | Netherlands | Inquire | ||
|---|---|---|---|---|
![]() |
+31 (50) 311-8007 | |||
![]() |
order@axonmedchem.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 2-(6-Chloro-3-Pyridinyl)-7-Azabicyclo[2.2.1]Heptane |
|---|---|
| Synonyms | ()-2-(6-Chloro-pyridin-3-yl)-7-aza-bicyclo[2.2.1]heptane; (-)-2-(6-Chloro-pyridin-3-yl)-7-aza-bicyclo[2.2.1]heptane; ()-epibatidine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 |
| CAS Registry Number | 148152-66-3 |
| SMILES | C1CC2C(CC1N2)C3=CN=C(C=C3)Cl |
| InChI | 1S/C11H13ClN2/c12-11-4-1-7(6-13-11)9-5-8-2-3-10(9)14-8/h1,4,6,8-10,14H,2-3,5H2 |
| InChIKey | NLPRAJRHRHZCQQ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.7±32.0°C at 760 mmHg (Cal.) |
| Flash point | 157.4±25.1°C (Cal.) |
| Refractive index | 1.577 (Cal.) |
| solubility | Soluble to 5 mM in water and to 100 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for 2-(6-Chloro-3-Pyridinyl)-7-Azabicyclo[2.2.1]Heptane |