|
CAS#: 14835-59-7 Product: N-(2-Biphenylyl)Phthalic Acid Imide No suppilers available for the product. |
| Name | N-(2-Biphenylyl)Phthalic Acid Imide |
|---|---|
| Synonyms | 2-(2-Phenylphenyl)Isoindoline-1,3-Dione; 2-(2-Phenylphenyl)Isoindoline-1,3-Quinone; N-(2-Biphenylyl)Phthalic Acid Imide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H13NO2 |
| Molecular Weight | 299.33 |
| CAS Registry Number | 14835-59-7 |
| SMILES | C1=CC=CC4=C1C(=O)N(C2=C(C=CC=C2)C3=CC=CC=C3)C4=O |
| InChI | 1S/C20H13NO2/c22-19-16-11-4-5-12-17(16)20(23)21(19)18-13-7-6-10-15(18)14-8-2-1-3-9-14/h1-13H |
| InChIKey | NGYOQODFXPCRIQ-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.593°C at 760 mmHg (Cal.) |
| Flash point | 232.472°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Biphenylyl)Phthalic Acid Imide |