|
CAS#: 14861-12-2 Product: 10-Nitro-5,6,7,8-Tetrahydrophenanthrene-1-Carboxylic Acid No suppilers available for the product. |
| Name | 10-Nitro-5,6,7,8-Tetrahydrophenanthrene-1-Carboxylic Acid |
|---|---|
| Synonyms | Nsc80803 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 |
| CAS Registry Number | 14861-12-2 |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)C(=CC3=C2CCCC3)[N+]([O-])=O |
| InChI | 1S/C15H13NO4/c17-15(18)12-7-3-6-11-10-5-2-1-4-9(10)8-13(14(11)12)16(19)20/h3,6-8H,1-2,4-5H2,(H,17,18) |
| InChIKey | IXLLAVBUXBNIQK-UHFFFAOYSA-N |
| Density | 1.393g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.934°C at 760 mmHg (Cal.) |
| Flash point | 215.598°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Nitro-5,6,7,8-Tetrahydrophenanthrene-1-Carboxylic Acid |