|
CAS#: 14875-91-3 Product: Copper-Neocuproine Complex No suppilers available for the product. |
| Name | Copper-Neocuproine Complex |
|---|---|
| Synonyms | Cupric 2,9-Dimethyl-1,10-Phenanthroline; Bis(2,9-Dimethyl-1,10-Phenanthroline-N(1),N(10))Copper(2+); Copper(2+), Bis(2,9-Dimethyl-1,10-Phenanthroline-N1,N10)- |
| Molecular Structure | ![]() |
| Molecular Formula | C28H24CuN4 |
| Molecular Weight | 480.07 |
| CAS Registry Number | 14875-91-3 |
| SMILES | [Cu++].C2=CC1=CC=C3C(=C1N=C2C)N=C(C=C3)C.C5=CC4=CC=C6C(=C4N=C5C)N=C(C=C6)C |
| InChI | 1S/2C14H12N2.Cu/c2*1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;/h2*3-8H,1-2H3;/q;;+2 |
| InChIKey | QGMZVDXJVMOGSN-UHFFFAOYSA-N |
| Boiling point | 367.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 159.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Copper-Neocuproine Complex |