|
CAS#: 14904-83-7 Product: 5-Amino-5-Deoxygluconic Acid delta-Lactam No suppilers available for the product. |
| Name | 5-Amino-5-Deoxygluconic Acid delta-Lactam |
|---|---|
| Synonyms | (3R,4S,5R,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)-2-Piperidinone; (3R,4S,5R,6R)-3,4,5-Trihydroxy-6-Methylol-2-Piperidone; Glucono-Delta-Lactam |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 14904-83-7 |
| SMILES | [C@@H]1(O)[C@@H](O)C(=O)N[C@@H]([C@H]1O)CO |
| InChI | 1S/C6H11NO5/c8-1-2-3(9)4(10)5(11)6(12)7-2/h2-5,8-11H,1H2,(H,7,12)/t2-,3-,4+,5-/m1/s1 |
| InChIKey | AJJXPYDGVXIEHE-SQOUGZDYSA-N |
| Density | 1.633g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.64°C at 760 mmHg (Cal.) |
| Flash point | 256.578°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-5-Deoxygluconic Acid delta-Lactam |