|
CAS#: 14908-64-6 Product: p-Tolyl Methacrylate No suppilers available for the product. |
| Name | p-Tolyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid (4-Methylphenyl) Ester; 2-Methylacrylic Acid (4-Methylphenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 |
| CAS Registry Number | 14908-64-6 |
| EINECS | 238-977-2 |
| SMILES | C1=C(OC(C(=C)C)=O)C=CC(=C1)C |
| InChI | 1S/C11H12O2/c1-8(2)11(12)13-10-6-4-9(3)5-7-10/h4-7H,1H2,2-3H3 |
| InChIKey | AOUAMFARIYTDLK-UHFFFAOYSA-N |
| Density | 1.029g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.135°C at 760 mmHg (Cal.) |
| Flash point | 108.497°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for p-Tolyl Methacrylate |