|
CAS#: 1492-55-3 Product: 7-Methylbenzo[a]Phenaleno[1,9-hi]Acridine No suppilers available for the product. |
| Name | 7-Methylbenzo[a]Phenaleno[1,9-hi]Acridine |
|---|---|
| Synonyms | Brn 1437748; Benzo(A)Phenaleno(1,9-Hi)Acridine, 7-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C28H17N |
| Molecular Weight | 367.45 |
| CAS Registry Number | 1492-55-3 |
| SMILES | C1=C7C5=C(C2=C1C(=C3C(=N2)C=CC4=CC=CC=C34)C)C=CC6=C5C(=CC=C6)C=C7 |
| InChI | 1S/C28H17N/c1-16-23-15-20-10-9-18-6-4-7-19-11-13-22(27(20)26(18)19)28(23)29-24-14-12-17-5-2-3-8-21(17)25(16)24/h2-15H,1H3 |
| InChIKey | LFBXCJCINUUCBS-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 645.965°C at 760 mmHg (Cal.) |
| Flash point | 285.277°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methylbenzo[a]Phenaleno[1,9-hi]Acridine |