| Name | p-Tolyl 4-Chlorobenzoate |
|---|---|
| Synonyms | 4-Chlorobenzoic Acid (4-Methylphenyl) Ester; Nsc11133; Zinc00225727 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.69 |
| CAS Registry Number | 15024-10-9 |
| SMILES | C1=C(C=CC(=C1)C)OC(C2=CC=C(C=C2)Cl)=O |
| InChI | 1S/C14H11ClO2/c1-10-2-8-13(9-3-10)17-14(16)11-4-6-12(15)7-5-11/h2-9H,1H3 |
| InChIKey | FNKKDQKBNWQMMW-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.597°C at 760 mmHg (Cal.) |
| Flash point | 182.009°C (Cal.) |
| (1) | B. Thimme Gowda, Ingrid Svoboda, K. S. Babitha and Hartmut Fuess . 4-Methylphenyl 4-chlorobenzoate , Acta Cryst (2008). E64, o88Â Â |
|---|---|
| Market Analysis Reports |
| List of Reports Available for p-Tolyl 4-Chlorobenzoate |