|
CAS#: 15037-55-5 Product: Ethonam Nitrate No suppilers available for the product. |
| Name | Ethonam Nitrate |
|---|---|
| Synonyms | Ethyl 3-Tetralin-1-Ylimidazole-4-Carboxylate; Nitric Acid; Nitric Acid; 3-(1-Tetralinyl)-4-Imidazolecarboxylic Acid Ethyl Ester; Nitric Acid; 3-Tetralin-1-Ylimidazole-4-Carboxylic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 |
| CAS Registry Number | 15037-55-5 |
| SMILES | C1=NC=C([N]1C3C2=CC=CC=C2CCC3)C(OCC)=O.O=[N+]([O-])O |
| InChI | 1S/C16H18N2O2.HNO3/c1-2-20-16(19)15-10-17-11-18(15)14-9-5-7-12-6-3-4-8-13(12)14;2-1(3)4/h3-4,6,8,10-11,14H,2,5,7,9H2,1H3;(H,2,3,4) |
| InChIKey | UOEKCNNIZWEMHG-UHFFFAOYSA-N |
| Boiling point | 469°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 237.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethonam Nitrate |