|
CAS#: 15053-99-3 Product: Pipethiadene No suppilers available for the product. |
| Name | Pipethiadene |
|---|---|
| Synonyms | 1-Methyl-4-Thieno(2,3-C)(2)-Benzothiepin-4(9H)-Ylidene Piperidine; Piperidine, 1-Methyl-4-Thieno(2,3-C)(2)Benzothiepin-4(9H)-Ylidene-; Pipethiaden |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19NS2 |
| Molecular Weight | 313.47 |
| CAS Registry Number | 15053-99-3 |
| SMILES | C1=CSC2=C1C(C3=C(CS2)C=CC=C3)=C4CCN(CC4)C |
| InChI | 1S/C18H19NS2/c1-19-9-6-13(7-10-19)17-15-5-3-2-4-14(15)12-21-18-16(17)8-11-20-18/h2-5,8,11H,6-7,9-10,12H2,1H3 |
| InChIKey | VZWWTHTUQTYAGH-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.949°C at 760 mmHg (Cal.) |
| Flash point | 239.226°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pipethiadene |