|
CAS#: 1505-95-9 Product: Naftypramide No suppilers available for the product. |
| Name | Naftypramide |
|---|---|
| Synonyms | 2-(2-Dimethylaminoethyl)-3-Methyl-2-(1-Naphthyl)Butanamide; 2-(2-Dimethylaminoethyl)-3-Methyl-2-(1-Naphthyl)Butyramide; 2-(2-Dimethylaminoethyl)-3-Methyl-2-Naphthalen-1-Yl-Butanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 |
| CAS Registry Number | 1505-95-9 |
| SMILES | C2=C(C(CCN(C)C)(C(C)C)C(N)=O)C1=CC=CC=C1C=C2 |
| InChI | 1S/C19H26N2O/c1-14(2)19(18(20)22,12-13-21(3)4)17-11-7-9-15-8-5-6-10-16(15)17/h5-11,14H,12-13H2,1-4H3,(H2,20,22) |
| InChIKey | XXFVRXJPEIBBEZ-UHFFFAOYSA-N |
| Density | 1.061g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.596°C at 760 mmHg (Cal.) |
| Flash point | 245.665°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naftypramide |