|
CAS#: 150624-46-7 Product: N-(6,7-Dihydroxy-2-Oxochromen-3-Yl)Formamide No suppilers available for the product. |
| Name | N-(6,7-Dihydroxy-2-Oxochromen-3-Yl)Formamide |
|---|---|
| Synonyms | N-(6,7-Dihydroxy-2-Oxo-Chromen-3-Yl)Formamide; N-(6,7-Dihydroxy-2-Oxo-3-Chromenyl)Formamide; N-(6,7-Dihydroxy-2-Keto-Chromen-3-Yl)Formamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.17 |
| CAS Registry Number | 150624-46-7 |
| SMILES | C1=C2C(=CC(=C1O)O)OC(=O)C(=C2)NC=O |
| InChI | 1S/C10H7NO5/c12-4-11-6-1-5-2-7(13)8(14)3-9(5)16-10(6)15/h1-4,13-14H,(H,11,12) |
| InChIKey | CQNMQTYIULLBAS-UHFFFAOYSA-N |
| Density | 1.671g/cm3 (Cal.) |
|---|---|
| Boiling point | 654.223°C at 760 mmHg (Cal.) |
| Flash point | 349.461°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(6,7-Dihydroxy-2-Oxochromen-3-Yl)Formamide |