|
CAS#: 151013-37-5 Product: (-)-5,6,8,13-Tetrahydro-8,13-Dioxo-1,6,7,9,11-Pentahydroxy-3-Pentyl-Benzo(a)Naphthacene-2-Carboxylic Acid No suppilers available for the product. |
| Name | (-)-5,6,8,13-Tetrahydro-8,13-Dioxo-1,6,7,9,11-Pentahydroxy-3-Pentyl-Benzo(a)Naphthacene-2-Carboxylic Acid |
|---|---|
| Synonyms | Bequinostatin A |
| Molecular Structure | ![]() |
| Molecular Formula | C28H24O9 |
| Molecular Weight | 504.49 |
| CAS Registry Number | 151013-37-5 |
| SMILES | C1=C4C(=C(O)C3=C1C2=C(O)C(=C(C=C2CC3O)CCCCC)C(=O)O)C(=O)C5=C(C4=O)C=C(O)C=C5O |
| InChI | 1S/C28H24O9/c1-2-3-4-5-11-6-12-7-17(30)21-14(19(12)25(33)20(11)28(36)37)10-16-23(26(21)34)27(35)22-15(24(16)32)8-13(29)9-18(22)31/h6,8-10,17,29-31,33-34H,2-5,7H2,1H3,(H,36,37) |
| InChIKey | RKXRXHADKSOULC-UHFFFAOYSA-N |
| Density | 1.57g/cm3 (Cal.) |
|---|---|
| Boiling point | 843.086°C at 760 mmHg (Cal.) |
| Flash point | 477.547°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (-)-5,6,8,13-Tetrahydro-8,13-Dioxo-1,6,7,9,11-Pentahydroxy-3-Pentyl-Benzo(a)Naphthacene-2-Carboxylic Acid |