|
CAS#: 15121-78-5 Product: 2,3-Dihydroxy-2-Phenylpropiophenone No suppilers available for the product. |
| Name | 2,3-Dihydroxy-2-Phenylpropiophenone |
|---|---|
| Synonyms | 2,3-Dihydroxy-2-Phenylpropiophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 15121-78-5 |
| EINECS | 239-177-6 |
| SMILES | C2=C(C(C(=O)C1=CC=CC=C1)(O)CO)C=CC=C2 |
| InChI | 1S/C15H14O3/c16-11-15(18,13-9-5-2-6-10-13)14(17)12-7-3-1-4-8-12/h1-10,16,18H,11H2 |
| InChIKey | AOGNACZDZNOTSN-UHFFFAOYSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.54°C at 760 mmHg (Cal.) |
| Flash point | 246.447°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydroxy-2-Phenylpropiophenone |