|
CAS#: 15165-69-2 Product: (2S)-2-(2,4-Dichlorophenoxy)Propanoic Acid No suppilers available for the product. |
| Name | (2S)-2-(2,4-Dichlorophenoxy)Propanoic Acid |
|---|---|
| Synonyms | (2S)-2-(2,4-Dichlorophenoxy)Propionic Acid; (S)-2-(2,4-Dichlorophenoxy)Propanoic Acid; Propanoic Acid, 2-(2,4-Dichlorophenoxy)-, (2S)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8Cl2O3 |
| Molecular Weight | 235.07 |
| CAS Registry Number | 15165-69-2 |
| SMILES | [C@H](C(O)=O)(OC1=C(Cl)C=C(Cl)C=C1)C |
| InChI | 1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)/t5-/m0/s1 |
| InChIKey | MZHCENGPTKEIGP-YFKPBYRVSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.349°C at 760 mmHg (Cal.) |
| Flash point | 164.476°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-(2,4-Dichlorophenoxy)Propanoic Acid |