Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Xylocoumarol |
|---|---|
| Synonyms | 3-(3,5-Dimethylphenyl)-2-Hydroxy-Chromen-4-One; 3-(3,5-Dimethylphenyl)-2-Hydroxy-4-Chromenone; 3-(3,5-Dimethylphenyl)-2-Hydroxy-Chromone |
| Molecular Structure |  |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 15301-97-0 |
| SMILES | C3=C(C2=C(OC1=CC=CC=C1C2=O)O)C=C(C=C3C)C |
| InChI | 1S/C17H14O3/c1-10-7-11(2)9-12(8-10)15-16(18)13-5-3-4-6-14(13)20-17(15)19/h3-9,19H,1-2H3 |
| InChIKey | KNEHRBHBJNBHSU-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.453°C at 760 mmHg (Cal.) |
| Flash point | 154.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Xylocoumarol |