|
CAS#: 15323-47-4 Product: Phosphorothioic Acid, O,O-Dimethyl O-2-Naphthalenyl Ester No suppilers available for the product. |
| Name | Phosphorothioic Acid, O,O-Dimethyl O-2-Naphthalenyl Ester |
|---|---|
| Synonyms | Dimethoxy-(2-Naphthyloxy)-Thioxo-Phosphorane; Dimethoxy-(2-Naphthyloxy)-Thioxophosphorane; Dimethoxy-Naphthalen-2-Yloxy-Sulfanylidene-Phosphorane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13O3PS |
| Molecular Weight | 268.27 |
| CAS Registry Number | 15323-47-4 |
| SMILES | C1=C2C(=CC=C1O[P](OC)(OC)=S)C=CC=C2 |
| InChI | 1S/C12H13O3PS/c1-13-16(17,14-2)15-12-8-7-10-5-3-4-6-11(10)9-12/h3-9H,1-2H3 |
| InChIKey | ONVNTTKHJBXLET-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.62°C at 760 mmHg (Cal.) |
| Flash point | 165.849°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphorothioic Acid, O,O-Dimethyl O-2-Naphthalenyl Ester |