|
CAS#: 153237-23-1 Product: 6-Deoxy-6-N-Octylamino-1,2-3,4-Di-O-Isopropylidene-alpha-D-Galactopyranose No suppilers available for the product. |
| Name | 6-Deoxy-6-N-Octylamino-1,2-3,4-Di-O-Isopropylidene-alpha-D-Galactopyranose |
|---|---|
| Synonyms | 6-Desoxy-6-N-Octylamino-1,2-3,4-Di-O-Isopropylidenegalactopyranose; 8-Rn-Dagal |
| Molecular Structure | ![]() |
| Molecular Formula | C20H37NO5 |
| Molecular Weight | 371.52 |
| CAS Registry Number | 153237-23-1 |
| SMILES | [C@H]12OC(O[C@H]1O[C@@H]([C@@H]3OC(O[C@H]23)(C)C)CNCCCCCCCC)(C)C |
| InChI | 1S/C20H37NO5/c1-6-7-8-9-10-11-12-21-13-14-15-16(24-19(2,3)23-15)17-18(22-14)26-20(4,5)25-17/h14-18,21H,6-13H2,1-5H3/t14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | SZYUTFXCQDKWOB-DISONHOPSA-N |
| Density | 1.007g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.441°C at 760 mmHg (Cal.) |
| Flash point | 195.182°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Deoxy-6-N-Octylamino-1,2-3,4-Di-O-Isopropylidene-alpha-D-Galactopyranose |