|
CAS#: 15358-22-2 Product: 1-[(5alpha,7alpha)-4,5-Epoxy-3,6-Dimethoxy-17-Methyl-6,14-Ethenomorphinan-7-Yl]Ethanone No suppilers available for the product. |
| Name | 1-[(5alpha,7alpha)-4,5-Epoxy-3,6-Dimethoxy-17-Methyl-6,14-Ethenomorphinan-7-Yl]Ethanone |
|---|---|
| Synonyms | Thevinone |
| Molecular Structure | ![]() |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 |
| CAS Registry Number | 15358-22-2 |
| EINECS | 239-393-0 |
| SMILES | [C@]125[C@@H]4[C@@]6([C@H](C[C@@]1([C@@H](CC3=C2C(=C(C=C3)OC)O4)N(C)CC5)C=C6)C(=O)C)OC |
| InChI | 1S/C23H27NO4/c1-13(25)15-12-21-7-8-23(15,27-4)20-22(21)9-10-24(2)17(21)11-14-5-6-16(26-3)19(28-20)18(14)22/h5-8,15,17,20H,9-12H2,1-4H3/t15-,17-,20-,21-,22+,23-/m1/s1 |
| InChIKey | DGSADVAMZWFCMP-LLGZQOTFSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.49°C at 760 mmHg (Cal.) |
| Flash point | 267.978°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(5alpha,7alpha)-4,5-Epoxy-3,6-Dimethoxy-17-Methyl-6,14-Ethenomorphinan-7-Yl]Ethanone |