|
CAS#: 154-99-4 Product: 2,4-Dimethyl-beta-phenylethylhydrazine dihydrogen sulfate No suppilers available for the product. |
| Name | 2,4-Dimethyl-beta-phenylethylhydrazine dihydrogen sulfate |
|---|---|
| Synonyms | Hydrazine, 1-(2,4-Dimethylphenethyl)-, Sulfate (1:1); Hydrazine, (2-(2,4-Dimethylphenyl)Ethyl)-, Sulfate (1:1) (9Ci); Lon 41 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.32 |
| CAS Registry Number | 154-99-4 |
| SMILES | O=[S](=O)(O)O.C1=C(C(=CC=C1C)CCNN)C |
| InChI | 1S/C10H16N2.H2O4S/c1-8-3-4-10(5-6-12-11)9(2)7-8;1-5(2,3)4/h3-4,7,12H,5-6,11H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | DKBQPURAHZHGQY-UHFFFAOYSA-N |
| Boiling point | 316.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 169.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethyl-beta-phenylethylhydrazine dihydrogen sulfate |