|
CAS#: 154106-10-2 Product: 1-Methyl-5-Methylsulfinyl-3-Phenyl-1,2,4-Triazole No suppilers available for the product. |
| Name | 1-Methyl-5-Methylsulfinyl-3-Phenyl-1,2,4-Triazole |
|---|---|
| Synonyms | 1-Methyl-5-(Methylsulfinyl)-3-Phenyl-1H-1,2,4-Triazole; 1H-1,2,4-Triazole, 1-Methyl-5-(Methylsulfinyl)-3-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 |
| CAS Registry Number | 154106-10-2 |
| SMILES | C2=C(C1=N[N](C(=N1)[S](=O)C)C)C=CC=C2 |
| InChI | 1S/C10H11N3OS/c1-13-10(15(2)14)11-9(12-13)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | WXHMEWGKWOEEJK-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.346°C at 760 mmHg (Cal.) |
| Flash point | 227.371°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-5-Methylsulfinyl-3-Phenyl-1,2,4-Triazole |