| Name | 1-(1-Diazoethyl)-4,5-Dimethoxy-2-Nitrobenzene |
|---|---|
| Synonyms | 1-(1-Diazoethyl)-4,5-Dimethoxy-2-Nitro-Benzene; 1-(4,5-Dimethoxy-2-Nitrophenyl)Diazoethane; Dmnpe |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21 |
| CAS Registry Number | 154140-56-4 |
| SMILES | C(C1=CC(=C(C=C1[N+](=O)[O-])OC)OC)(C)=[N+]=[N-] |
| InChI | 1S/C10H11N3O4/c1-6(12-11)7-4-9(16-2)10(17-3)5-8(7)13(14)15/h4-5H,1-3H3 |
| InChIKey | YGTNHTPZQUQMKP-UHFFFAOYSA-N |
| (1) | Blidner Richard A.. Photoinduced RNA interference using DMNPE-caged 2′-deoxy-2′-fluoro substituted nucleic acids in vitro and in vivo, Molecular BioSystems, 2008 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(1-Diazoethyl)-4,5-Dimethoxy-2-Nitrobenzene |