| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 7-Chloro-2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptanoic Acid |
|---|---|
| Synonyms | 7-Chlorododecafluoroheptanoic acid; 7-Chloroperfluoroheptanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7HClF12O2 |
| Molecular Weight | 380.52 |
| CAS Registry Number | 1550-24-9 |
| SMILES | FC(F)(C(F)(F)C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(Cl)(F)F |
| InChI | 1S/C7HClF12O2/c8-7(19,20)6(17,18)5(15,16)4(13,14)3(11,12)2(9,10)1(21)22/h(H,21,22) |
| InChIKey | WMFYUMIVMKSLSX-UHFFFAOYSA-N |
| Density | 1.764g/cm3 (Cal.) |
|---|---|
| Melting point | 42-43°C (Expl.) |
| Boiling point | 196-198°C (Expl.) |
| 209.926°C at 760 mmHg (Cal.) | |
| Flash point | 80.761°C (Cal.) |
| Refractive index | 1.319 (Cal.) |
| Safety Description | Corrosive/Irritant |
|---|---|
| R34,R36/37/38 | |
| S23,S24/25,S26,S36/37/39,S45 | |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptanoic Acid |