|
CAS#: 15509-51-0 Product: 1-Bromo-1-Nitro-Octan-2-Ol No suppilers available for the product. |
| Name | 1-Bromo-1-Nitro-Octan-2-Ol |
|---|---|
| Synonyms | 1-Bromo-1-Nitro-Octan-2-Ol; Nsc523923 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H16BrNO3 |
| Molecular Weight | 254.12 |
| CAS Registry Number | 15509-51-0 |
| SMILES | C(C)CCCCC(O)C([N+]([O-])=O)Br |
| InChI | 1S/C8H16BrNO3/c1-2-3-4-5-6-7(11)8(9)10(12)13/h7-8,11H,2-6H2,1H3 |
| InChIKey | GWNCZMMMYVYUCI-UHFFFAOYSA-N |
| Density | 1.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.213°C at 760 mmHg (Cal.) |
| Flash point | 137.783°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-1-Nitro-Octan-2-Ol |