|
CAS#: 15595-24-1 Product: 3,3'-Dichloro-5,5'-Dinitro-1,1'-Biphenyl-2,2'-Diol No suppilers available for the product. |
| Name | 3,3'-Dichloro-5,5'-Dinitro-1,1'-Biphenyl-2,2'-Diol |
|---|---|
| Synonyms | 2-Chloro-6-(3-Chloro-2-Hydroxy-5-Nitro-Phenyl)-4-Nitro-Phenol; (1,1'-Biphenyl)-2,2'-Diol, 3,3'-Dichloro-5,5'-Dinitro-; 3,3'-Dichloro-5,5'-Dinitro-(1,1'-Biphenyl)-2,2'-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl2N2O6 |
| Molecular Weight | 345.10 |
| CAS Registry Number | 15595-24-1 |
| SMILES | C2=C(C1=C(O)C(=CC(=C1)[N+]([O-])=O)Cl)C(=C(Cl)C=C2[N+]([O-])=O)O |
| InChI | 1S/C12H6Cl2N2O6/c13-9-3-5(15(19)20)1-7(11(9)17)8-2-6(16(21)22)4-10(14)12(8)18/h1-4,17-18H |
| InChIKey | JMDGYNMVECCCBV-UHFFFAOYSA-N |
| Density | 1.733g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.753°C at 760 mmHg (Cal.) |
| Flash point | 252.413°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Dichloro-5,5'-Dinitro-1,1'-Biphenyl-2,2'-Diol |