|
CAS#: 15599-44-7 Product: Spirazine No suppilers available for the product. |
| Name | Spirazine |
|---|---|
| Synonyms | [4-Amino-1-(4-Chlorophenyl)-9-Methyl-1,3,5-Triazaspiro[5.5]Undeca-2,4-Dien-2-Yl]Amine; 1,3,5-Triazaspiro(5.5)Undeca-1,3-Diene, 2,4-Diamino-5-(P-Chlorophenyl)-9-Methyl-; 1,3,5-Triazaspiro(5.5)Undeca-1,3-Diene-2,4-Diamine, 5-(4-Chlorophenyl)-9-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20ClN5 |
| Molecular Weight | 305.81 |
| CAS Registry Number | 15599-44-7 |
| SMILES | C1=CC(=CC=C1N2C3(N=C(N)N=C2N)CCC(C)CC3)Cl |
| InChI | 1S/C15H20ClN5/c1-10-6-8-15(9-7-10)20-13(17)19-14(18)21(15)12-4-2-11(16)3-5-12/h2-5,10H,6-9H2,1H3,(H4,17,18,19,20) |
| InChIKey | VVMKZMXFFVPKJM-UHFFFAOYSA-N |
| Density | 1.415g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.652°C at 760 mmHg (Cal.) |
| Flash point | 242.675°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Spirazine |