|
CAS#: 156312-10-6 Product: 7,8-Dichloro-9-Methylpyrido[3,4-b]Indole No suppilers available for the product. |
| Name | 7,8-Dichloro-9-Methylpyrido[3,4-b]Indole |
|---|---|
| Synonyms | 7,8-Dichloro-9-Methyl-Pyrido[3,4-B]Indole; 7,8-Dichloro-9-Methyl-$B-Carboline; 7,8-Dichloro-9-Methyl-9H-Pyrido(3,4-B)Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl2N2 |
| Molecular Weight | 251.11 |
| CAS Registry Number | 156312-10-6 |
| SMILES | C1=CC(=C(Cl)C2=C1C3=C([N]2C)C=NC=C3)Cl |
| InChI | 1S/C12H8Cl2N2/c1-16-10-6-15-5-4-7(10)8-2-3-9(13)11(14)12(8)16/h2-6H,1H3 |
| InChIKey | XGTYSLIGRKUXED-UHFFFAOYSA-N |
| Density | 1.447g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.304°C at 760 mmHg (Cal.) |
| Flash point | 214.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8-Dichloro-9-Methylpyrido[3,4-b]Indole |