|
CAS#: 157047-97-7 Product: Benzomalvin B No suppilers available for the product. |
| Name | Benzomalvin B |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C24H17N3O2 |
| Molecular Weight | 379.42 |
| CAS Registry Number | 157047-97-7 |
| SMILES | C1=CC=CC2=C1C(=O)N(C(/C3=NC4=C(C(N23)=O)C=CC=C4)=C/C5=CC=CC=C5)C |
| InChI | 1S/C24H17N3O2/c1-26-21(15-16-9-3-2-4-10-16)22-25-19-13-7-5-11-17(19)24(29)27(22)20-14-8-6-12-18(20)23(26)28/h2-15H,1H3/b21-15+ |
| InChIKey | HXDZMNFJQNZXKW-RCCKNPSSSA-N |
| Density | 1.281g/cm3 (Cal.) |
|---|---|
| Boiling point | 612.149°C at 760 mmHg (Cal.) |
| Flash point | 324.016°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Benzomalvin B |