|
CAS#: 15720-98-6 Product: Octadecafluoro-9-(Trifluoromethyl)Decanoyl Fluoride No suppilers available for the product. |
| Name | Octadecafluoro-9-(Trifluoromethyl)Decanoyl Fluoride |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-Octadecafluoro-9-(Trifluoromethyl)Capryl Fluoride; Decanoyl Fluoride, Octadecafluoro-9-(Trifluoromethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11F22O |
| Molecular Weight | 566.09 |
| CAS Registry Number | 15720-98-6 |
| EINECS | 239-814-8 |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C11F22O/c12-1(34)2(13,14)4(16,17)6(20,21)8(24,25)9(26,27)7(22,23)5(18,19)3(15,10(28,29)30)11(31,32)33 |
| InChIKey | YEONIHINJPEQCM-UHFFFAOYSA-N |
| Density | 1.728g/cm3 (Cal.) |
|---|---|
| Boiling point | 175.055°C at 760 mmHg (Cal.) |
| Flash point | 63.459°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octadecafluoro-9-(Trifluoromethyl)Decanoyl Fluoride |