|
CAS#: 158204-25-2 Product: 3-Methyl-4-[(1E,3E,5E)-6-Methyl-7-Oxoocta-1,3,5-Trienyl]Furan-2,5-Dione No suppilers available for the product. |
| Name | 3-Methyl-4-[(1E,3E,5E)-6-Methyl-7-Oxoocta-1,3,5-Trienyl]Furan-2,5-Dione |
|---|---|
| Synonyms | 3-Methyl-4-[(1E,3E,5E)-6-Methyl-7-Oxo-Octa-1,3,5-Trienyl]Furan-2,5-Dione; 3-[(1E,3E,5E)-7-Keto-6-Methyl-Octa-1,3,5-Trienyl]-4-Methyl-Furan-2,5-Quinone; 2,5-Furandione, 3-Methyl-4-(6-Methyl-7-Oxo-1,3,5-Octatrienyl)-, (E,E,E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 |
| CAS Registry Number | 158204-25-2 |
| SMILES | CC1=C(C(OC1=O)=O)\C=C\C=C\C=C(C(=O)C)/C |
| InChI | 1S/C14H14O4/c1-9(11(3)15)7-5-4-6-8-12-10(2)13(16)18-14(12)17/h4-8H,1-3H3/b5-4+,8-6+,9-7+ |
| InChIKey | DPZNQXPHRMGJIG-WUJFNTSISA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.783°C at 760 mmHg (Cal.) |
| Flash point | 184.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-4-[(1E,3E,5E)-6-Methyl-7-Oxoocta-1,3,5-Trienyl]Furan-2,5-Dione |