Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 6-Methyl-4,5-Diazaspiro[2.4]Hept-4-Ene-6-Carboxylate |
|---|---|
| Synonyms | methyl 6-methyl-4,5-diazaspiro[2.4]hept-4-ene-6-carboxylate |
| Molecular Structure | ![CAS#: 158664-54-1, Methyl 6-Methyl-4,5-Diazaspiro[2.4]Hept-4-Ene-6-Carboxylate](/moreStructures/158664-54-1.gif) |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.19 |
| CAS Registry Number | 158664-54-1 |
| SMILES | CC/2(CC1(CC1)\N=N\2)C(=O)OC |
| InChI | 1S/C8H12N2O2/c1-7(6(11)12-2)5-8(3-4-8)10-9-7/h3-5H2,1-2H3 |
| InChIKey | IMGUSOZEWKKOJE-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 213.386°C at 760 mmHg (Cal.) |
| Flash point | 85.146°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 6-Methyl-4,5-Diazaspiro[2.4]Hept-4-Ene-6-Carboxylate |