|
CAS#: 159092-67-8 Product: 1,6-Dinitrophenanthrene No suppilers available for the product. |
| Name | 1,6-Dinitrophenanthrene |
|---|---|
| Synonyms | Ccris 7649; Phenanthrene, 1,6-Dinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8N2O4 |
| Molecular Weight | 268.23 |
| CAS Registry Number | 159092-67-8 |
| SMILES | C3=C2C1=CC=CC(=C1C=CC2=CC=C3[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C14H8N2O4/c17-15(18)10-6-4-9-5-7-12-11(13(9)8-10)2-1-3-14(12)16(19)20/h1-8H |
| InChIKey | GSWPGZWSWHARES-UHFFFAOYSA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.384°C at 760 mmHg (Cal.) |
| Flash point | 254.945°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dinitrophenanthrene |