|
CAS#: 159551-36-7 Product: 2,2,2-Trifluoro-1-[(3aR,7aR)-Octahydro-1H-Indol-1-Yl]Ethanone No suppilers available for the product. |
| Name | 2,2,2-Trifluoro-1-[(3aR,7aR)-Octahydro-1H-Indol-1-Yl]Ethanone |
|---|---|
| Synonyms | 2,2,2-tri |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 |
| CAS Registry Number | 159551-36-7 |
| SMILES | C1CC[C@@H]2[C@H](C1)CCN2C(=O)C(F)(F)F |
| InChI | 1S/C10H14F3NO/c11-10(12,13)9(15)14-6-5-7-3-1-2-4-8(7)14/h7-8H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | OBPDFBRFKVKZAJ-HTQZYQBOSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.489°C at 760 mmHg (Cal.) |
| Flash point | 137.95°C (Cal.) |
| Refractive index | 1.45 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trifluoro-1-[(3aR,7aR)-Octahydro-1H-Indol-1-Yl]Ethanone |