|
CAS#: 160455-70-9 Product: 2,4-Bis(Oxiran-2-Ylmethyl)-5-Propan-2-Yl-1,2,4-Triazol-3-One No suppilers available for the product. |
| Name | 2,4-Bis(Oxiran-2-Ylmethyl)-5-Propan-2-Yl-1,2,4-Triazol-3-One |
|---|---|
| Synonyms | 5-Isopropyl-2,4-Bis(Oxiran-2-Ylmethyl)-1,2,4-Triazol-3-One; 5-Isopropyl-2,4-Bis(2-Oxiranylmethyl)-1,2,4-Triazol-3-One; 2,4-Diglycidyl-5-Isopropyl-1,2,4-Triazol-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 |
| CAS Registry Number | 160455-70-9 |
| SMILES | C(N1C(N(N=C1C(C)C)CC2OC2)=O)C3OC3 |
| InChI | 1S/C11H17N3O3/c1-7(2)10-12-14(4-9-6-17-9)11(15)13(10)3-8-5-16-8/h7-9H,3-6H2,1-2H3 |
| InChIKey | NCUJZPXJVIWNMT-UHFFFAOYSA-N |
| Density | 1.505g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.022°C at 760 mmHg (Cal.) |
| Flash point | 158.835°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis(Oxiran-2-Ylmethyl)-5-Propan-2-Yl-1,2,4-Triazol-3-One |