|
CAS#: 16054-41-4 Product: 1,2-Bis(Dichloroacetyl)Hydrazine No suppilers available for the product. |
| Name | 1,2-Bis(Dichloroacetyl)Hydrazine |
|---|---|
| Synonyms | 2,2-Dichloro-N'-(2,2-Dichloro-1-Oxoethyl)Acetohydrazide; 2,2-Dichloro-N'-(2,2-Dichloroethanoyl)Ethanehydrazide; 1,2-Bis(Dichloroacetyl)Hydrazine |
| Molecular Structure | ![]() |
| Molecular Formula | C4H4Cl4N2O2 |
| Molecular Weight | 253.90 |
| CAS Registry Number | 16054-41-4 |
| SMILES | O=C(C(Cl)Cl)NNC(C(Cl)Cl)=O |
| InChI | 1S/C4H4Cl4N2O2/c5-1(6)3(11)9-10-4(12)2(7)8/h1-2H,(H,9,11)(H,10,12) |
| InChIKey | WOJKJUQKPSGJCT-UHFFFAOYSA-N |
| Density | 1.662g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.078°C at 760 mmHg (Cal.) |
| Flash point | 197.575°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(Dichloroacetyl)Hydrazine |