|
CAS#: 1608-40-8 Product: 1,4-Bis[(Z)-2-Phenylethenyl]Benzene No suppilers available for the product. |
| Name | 1,4-Bis[(Z)-2-Phenylethenyl]Benzene |
|---|---|
| Synonyms | Nsc157363; 1-[(E)-2-Phenylethenyl]-4-[(Z)-2-Phenylethenyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.38 |
| CAS Registry Number | 1608-40-8 |
| SMILES | C1=C(C=CC(=C1)\C=C/C2=CC=CC=C2)\C=C\C3=CC=CC=C3 |
| InChI | 1S/C22H18/c1-3-7-19(8-4-1)11-13-21-15-17-22(18-16-21)14-12-20-9-5-2-6-10-20/h1-18H/b13-11-,14-12+ |
| InChIKey | IJAAWBHHXIWAHM-HEEUSZRZSA-N |
| Density | 1.104g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.609°C at 760 mmHg (Cal.) |
| Flash point | 217.699°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis[(Z)-2-Phenylethenyl]Benzene |