|
CAS#: 16106-81-3 Product: 1,11-Dichloro-1,1,3,3,5,5,7,7,9,9,11,11-Dodecamethylhexasiloxane No suppilers available for the product. |
| Name | 1,11-Dichloro-1,1,3,3,5,5,7,7,9,9,11,11-Dodecamethylhexasiloxane |
|---|---|
| Synonyms | 1,11-Dich |
| Molecular Structure | ![]() |
| Molecular Formula | C12H36Cl2O5Si6 |
| Molecular Weight | 499.83 |
| CAS Registry Number | 16106-81-3 |
| SMILES | Cl[Si](O[Si](O[Si](O[Si](O[Si](O[Si](Cl)(C)C)(C)C)(C)C)(C)C)(C)C)(C)C |
| InChI | 1S/C12H36Cl2O5Si6/c1-20(2,13)15-22(5,6)17-24(9,10)19-25(11,12)18-23(7,8)16-21(3,4)14/h1-12H3 |
| InChIKey | IHILIQBLBAJDOJ-UHFFFAOYSA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.202°C at 760 mmHg (Cal.) |
| Flash point | 131.8°C (Cal.) |
| Refractive index | 1.431 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,11-Dichloro-1,1,3,3,5,5,7,7,9,9,11,11-Dodecamethylhexasiloxane |