Online Database of Chemicals from Around the World
|
CAS#: 1614-30-8 Product: [4-[4-(Carbamothioylamino)Phenyl]Phenyl]Thiourea No suppilers available for the product. |
| Name | [4-[4-(Carbamothioylamino)Phenyl]Phenyl]Thiourea |
|---|---|
| Synonyms | [4-[4-(Thiocarbamoylamino)Phenyl]Phenyl]Thiourea; 0-13-00-00229 (Beilstein Handbook Reference); 4,4'-Biphenylene Bis(Thiourea) |
| Molecular Structure | ![CAS#: 1614-30-8, [4-[4-(Carbamothioylamino)Phenyl]Phenyl]Thiourea](/moreStructures/1614-30-8.gif) |
| Molecular Formula | C14H14N4S2 |
| Molecular Weight | 302.41 |
| CAS Registry Number | 1614-30-8 |
| SMILES | C1=CC(=CC=C1NC(=S)N)C2=CC=C(C=C2)NC(N)=S |
| InChI | 1S/C14H14N4S2/c15-13(19)17-11-5-1-9(2-6-11)10-3-7-12(8-4-10)18-14(16)20/h1-8H,(H3,15,17,19)(H3,16,18,20) |
| InChIKey | FAOJSYHCXVRQKK-UHFFFAOYSA-N |
| Density | 1.434g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.893°C at 760 mmHg (Cal.) |
| Flash point | 257.336°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-[4-(Carbamothioylamino)Phenyl]Phenyl]Thiourea |