|
CAS#: 1614-57-9 Product: N,N-Dimethyl-5H-Dibenzo(a,d)Cycloheptene-5-Propylamine Hydrochloride No suppilers available for the product. |
| Name | N,N-Dimethyl-5H-Dibenzo(a,d)Cycloheptene-5-Propylamine Hydrochloride |
|---|---|
| Synonyms | Lu 3-068 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24ClN |
| Molecular Weight | 313.87 |
| CAS Registry Number | 1614-57-9 |
| SMILES | C3=C2C(C1=CC=CC=C1C=CC2=CC=C3)CCC[NH+](C)C.[Cl-] |
| InChI | 1S/C20H23N.ClH/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;/h3-6,8-11,13-14,20H,7,12,15H2,1-2H3;1H |
| InChIKey | VBKNNJQOMLOXQL-UHFFFAOYSA-N |
| Boiling point | 406.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 178.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-5H-Dibenzo(a,d)Cycloheptene-5-Propylamine Hydrochloride |