|
CAS#: 16156-93-7 Product: 1-[2-(2-Chloroethoxy)Ethyl]-2-Methyl-5-Nitro-1H-Imidazole No suppilers available for the product. |
| Name | 1-[2-(2-Chloroethoxy)Ethyl]-2-Methyl-5-Nitro-1H-Imidazole |
|---|---|
| Synonyms | 1-[2-(2-Chloroethoxy)Ethyl]-2-Methyl-5-Nitro-Imidazole; 5-23-05-00064 (Beilstein Handbook Reference); Brn 0615607 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12ClN3O3 |
| Molecular Weight | 233.65 |
| CAS Registry Number | 16156-93-7 |
| SMILES | C1=C([N](C(=N1)C)CCOCCCl)[N+]([O-])=O |
| InChI | 1S/C8H12ClN3O3/c1-7-10-6-8(12(13)14)11(7)3-5-15-4-2-9/h6H,2-5H2,1H3 |
| InChIKey | YNVBDRPGHSFRGV-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.829°C at 760 mmHg (Cal.) |
| Flash point | 205.891°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-(2-Chloroethoxy)Ethyl]-2-Methyl-5-Nitro-1H-Imidazole |