|
CAS#: 16156-96-0 Product: 1-(2-Iodoethyl)-2-Methyl-4-Nitro-1H-Imidazole No suppilers available for the product. |
| Name | 1-(2-Iodoethyl)-2-Methyl-4-Nitro-1H-Imidazole |
|---|---|
| Synonyms | 1-(2-Iodoethyl)-2-Methyl-4-Nitro-Imidazole; Brn 0515298; Imidazole, 1-(2-Iodoethyl)-2-Methyl-4-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8IN3O2 |
| Molecular Weight | 281.05 |
| CAS Registry Number | 16156-96-0 |
| SMILES | C1=C(N=C(C)[N]1CCI)[N+]([O-])=O |
| InChI | 1S/C6H8IN3O2/c1-5-8-6(10(11)12)4-9(5)3-2-7/h4H,2-3H2,1H3 |
| InChIKey | WIQJRGFUJZSBKC-UHFFFAOYSA-N |
| Density | 2.034g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.102°C at 760 mmHg (Cal.) |
| Flash point | 192.751°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Iodoethyl)-2-Methyl-4-Nitro-1H-Imidazole |