|
CAS#: 16202-79-2 Product: (3S,3aS,6R)-2,3,4,5,6,7-Hexahydro-7,7,8-trimethyl-1H-3a,6-Methanoazulene-3-carboxylicacid No suppilers available for the product. |
| Name | (3S,3aS,6R)-2,3,4,5,6,7-Hexahydro-7,7,8-trimethyl-1H-3a,6-Methanoazulene-3-carboxylicacid |
|---|---|
| Synonyms | 1H-3A.Alpha.,6-Methanoazulene-3-Carboxylic Acid, 2,3.Beta.,4,5,6.Beta.,7-Hexahydro-7,7,8-Trimethyl-; 1H-3A,6-Methanoazulene-3-Carboxylic Acid, 2,3,4,5,6,7-Hexahydro-7,7,8-Trimethyl-, [3S-(3.Alpha.,3A.Alpha.,6.Alpha.)]- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 16202-79-2 |
| SMILES | CC2=C1C3(C(C(=O)O)CC1)CC(C2(C)C)CC3 |
| InChI | 1S/C15H22O2/c1-9-11-4-5-12(13(16)17)15(11)7-6-10(8-15)14(9,2)3/h10,12H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | DHPMFKAJSXGYDJ-UHFFFAOYSA-N |
| Density | 1.12g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.624°C at 760 mmHg (Cal.) |
| Flash point | 172.235°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3S,3aS,6R)-2,3,4,5,6,7-Hexahydro-7,7,8-trimethyl-1H-3a,6-Methanoazulene-3-carboxylicacid |