|
CAS#: 16212-85-4 Product: 3,6-Diphenyldithiine No suppilers available for the product. |
| Name | 3,6-Diphenyldithiine |
|---|---|
| Synonyms | 3,6-Di(Phenyl)-1,2-Dithiine; 3,6-Diphenyl-1,2-Dithiin |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12S2 |
| Molecular Weight | 268.39 |
| CAS Registry Number | 16212-85-4 |
| SMILES | C3=C(C1=CC=C(SS1)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C16H12S2/c1-3-7-13(8-4-1)15-11-12-16(18-17-15)14-9-5-2-6-10-14/h1-12H |
| InChIKey | TWFJKRAZUIJOSQ-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.349°C at 760 mmHg (Cal.) |
| Flash point | 323.314°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6-Diphenyldithiine |