|
CAS#: 16218-31-8 Product: 2-Iodophenanthrene-9,10-Dione No suppilers available for the product. |
| Name | 2-Iodophenanthrene-9,10-Dione |
|---|---|
| Synonyms | 2-Iodophenanthrene-9,10-Quinone; Nsc523087 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H7IO2 |
| Molecular Weight | 334.11 |
| CAS Registry Number | 16218-31-8 |
| SMILES | C1=CC2=C(C=C1I)C(=O)C(C3=C2C=CC=C3)=O |
| InChI | 1S/C14H7IO2/c15-8-5-6-10-9-3-1-2-4-11(9)13(16)14(17)12(10)7-8/h1-7H |
| InChIKey | NKXXGBGMYWPUSM-UHFFFAOYSA-N |
| Density | 1.844g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.595°C at 760 mmHg (Cal.) |
| Flash point | 239.012°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Iodophenanthrene-9,10-Dione |