|
CAS#: 16286-54-7 Product: (2,6-Dimethylphenoxy)(Trimethyl)Silane No suppilers available for the product. |
| Name | (2,6-Dimethylphenoxy)(Trimethyl)Silane |
|---|---|
| Synonyms | (2,6-Dimethylphenoxy)(trimethyl)silane; 2,6-Dimethylphenol, TMS ether |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18OSi |
| Molecular Weight | 194.35 |
| CAS Registry Number | 16286-54-7 |
| SMILES | O(c1c(cccc1C)C)[Si](C)(C)C |
| InChI | 1S/C11H18OSi/c1-9-7-6-8-10(2)11(9)12-13(3,4)5/h6-8H,1-5H3 |
| InChIKey | MNBNTAKLVREHDB-UHFFFAOYSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 224.636°C at 760 mmHg (Cal.) |
| Flash point | 83.544°C (Cal.) |
| Refractive index | 1.476 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,6-Dimethylphenoxy)(Trimethyl)Silane |