|
CAS#: 16325-38-5 Product: 1,2,4,5-Tetrachloro-3,6-Bis(Isocyanatomethyl)Benzene No suppilers available for the product. |
| Name | 1,2,4,5-Tetrachloro-3,6-Bis(Isocyanatomethyl)Benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H4Cl4N2O2 |
| Molecular Weight | 325.96 |
| CAS Registry Number | 16325-38-5 |
| SMILES | Clc1c(C\N=C=O)c(Cl)c(Cl)c(C/N=C=O)c1Cl |
| InChI | 1S/C10H4Cl4N2O2/c11-7-5(1-15-3-17)8(12)10(14)6(9(7)13)2-16-4-18/h1-2H2 |
| InChIKey | UXIKMAOGSBQRNJ-UHFFFAOYSA-N |
| Density | 1.579g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.79°C at 760 mmHg (Cal.) |
| Flash point | 147.683°C (Cal.) |
| Refractive index | 1.617 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5-Tetrachloro-3,6-Bis(Isocyanatomethyl)Benzene |