|
CAS#: 16378-21-5 Product: Piroheptine No suppilers available for the product. |
| Name | Piroheptine |
|---|---|
| Synonyms | Pyrrolidine, 3-(10,11-Dihydro-5H-Dibenzo(A,D)Cyclohepten-5-Ylidene)-1-Ethyl-2-Methyl-, Hydrochloride; Trimol; D01231 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H26ClN |
| Molecular Weight | 339.91 |
| CAS Registry Number | 16378-21-5 (16378-22-6) |
| SMILES | [H+].C4=C3C(=C1C(N(CC1)CC)C)C2=CC=CC=C2CCC3=CC=C4.[Cl-] |
| InChI | 1S/C22H25N.ClH/c1-3-23-15-14-19(16(23)2)22-20-10-6-4-8-17(20)12-13-18-9-5-7-11-21(18)22;/h4-11,16H,3,12-15H2,1-2H3;1H |
| InChIKey | PLJNHZOEOXGWIR-UHFFFAOYSA-N |
| Boiling point | 434.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 191.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Piroheptine |