|
CAS#: 16412-36-5 Product: 2-Methyl-4-(1H-Purin-6-Ylamino)-2-Butanol No suppilers available for the product. |
| Name | 2-Methyl-4-(1H-Purin-6-Ylamino)-2-Butanol |
|---|---|
| Synonyms | 2-Butanol, 2-Methyl-4-(1H-Purin-6-Ylamino)-; 2-Butanol, 2-Methyl-4-(Purin-6-Ylamino)-; 2-Methyl-4-(1H-Purin-6-Ylamino)-2-Butanol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 |
| CAS Registry Number | 16412-36-5 |
| SMILES | C1=NC2=C([NH]1)C(=NC=N2)NCCC(O)(C)C |
| InChI | 1S/C10H15N5O/c1-10(2,16)3-4-11-8-7-9(13-5-12-7)15-6-14-8/h5-6,16H,3-4H2,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | BYBQVYKESCJUMW-UHFFFAOYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.221°C at 760 mmHg (Cal.) |
| Flash point | 287.773°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-(1H-Purin-6-Ylamino)-2-Butanol |