|
CAS#: 16416-27-6 Product: 4-Phenyl-2,3-Dioxo-2-Buten-4-Olide No suppilers available for the product. |
| Name | 4-Phenyl-2,3-Dioxo-2-Buten-4-Olide |
|---|---|
| Synonyms | 5-Phenyltetrahydrofuran-2,3,4-Trione; 4-Pdob; 4-Phenyl-2,3-Dioxo-2-Buten-4-Olide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6O4 |
| Molecular Weight | 190.16 |
| CAS Registry Number | 16416-27-6 |
| SMILES | C1=CC=CC=C1C2OC(C(C2=O)=O)=O |
| InChI | 1S/C10H6O4/c11-7-8(12)10(13)14-9(7)6-4-2-1-3-5-6/h1-5,9H |
| InChIKey | OIYUNDWAIWJGBI-UHFFFAOYSA-N |
| Density | 1.425g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.201°C at 760 mmHg (Cal.) |
| Flash point | 141.109°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Phenyl-2,3-Dioxo-2-Buten-4-Olide |