|
CAS#: 16424-67-2 Product: 5,5-Diethyl-2,2,3,3-Tetramethyl-4-Heptanone No suppilers available for the product. |
| Name | 5,5-Diethyl-2,2,3,3-Tetramethyl-4-Heptanone |
|---|---|
| Synonyms | 5,5-Diethyl-2,2,3,3-Tetramethyl-Heptan-4-One; 4-Heptanone, 5,5-Diethyl-2,2,3,3-Tetramethyl-; 5,5-Diethyl-2,2,3,3-Tetramethyl-4-Heptanone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 |
| CAS Registry Number | 16424-67-2 |
| SMILES | C(C(C(=O)C(C)(C)C(C)(C)C)(CC)CC)C |
| InChI | 1S/C15H30O/c1-9-15(10-2,11-3)12(16)14(7,8)13(4,5)6/h9-11H2,1-8H3 |
| InChIKey | BUAHEEAPBZIWMZ-UHFFFAOYSA-N |
| Density | 0.828g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.636°C at 760 mmHg (Cal.) |
| Flash point | 65.821°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Diethyl-2,2,3,3-Tetramethyl-4-Heptanone |